Systematic / IUPAC Name: 2-(Ethylamino)-2-thiophen-2-ylcyclohexan-1-one
ID: Reference2116
Other Names:
Cyclohexanone, 2-(ethylamino)-2-(2-thienyl)-;
2-(Ethylamino)-2-(2-thienyl)cyclohexanone;
2-(Ethylamino)-2-thiophen-2-yl-1-cyclohexanone
Formula: C12H17NOS
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs Sports Doping Drugs
Tiletamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/27/2015 3:14:51 PM |
| InChI | InChI=1S/C12H17NOS/c1-2-13-12(11-7-5-9-15-11)8-4-3-6-10(12)14/h5,7,9,13H,2-4,6,8H2,1H3 |
| InChI Key | QAXBVGVYDCAVLV-UHFFFAOYSA-N |
| Canonical SMILES | CCNC1(CCCCC1=O)C2=CC=CS2 |
| CAS | 14176499 |
| Splash | |
| Other Names |
Cyclohexanone, 2-(ethylamino)-2-(2-thienyl)-; 2-(Ethylamino)-2-(2-thienyl)cyclohexanone; 2-(Ethylamino)-2-thiophen-2-yl-1-cyclohexanone |
| Wikipedia | Tiletamine |
| ChEMBL | CHEMBL2110703 |
| ChemIDPlus | 014176499; 060893972 |
| PubChem | 26533 |
| ChemSpider | 24714 |
| KEGG | D08596 |