Systematic / IUPAC Name: (2S,5R,6R)-6-{[(2S)-2-Carboxy-2-(3-thienyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
ID: Reference2120
Other Names:
Formula: C15H16N2O6S2
Class: Therapeutics/Prescription Drugs
Ticarcillin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/28/2015 10:40:26 AM |
| InChI | InChI=1S/C15H16N2O6S2/c1-15(2)9(14(22)23)17-11(19)8(12(17)25-15)16-10(18)7(13(20)21)6-3-4-24-5-6/h3-5,7-9,12H,1-2H3,(H,16,18)(H,20,21)(H,22,23)/t7-,8+,9-,12+/m0/s1 |
| InChI Key | OHKOGUYZJXTSFX-KIKITERTSA-N |
| Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CSC=C3)C(=O)O)C(=O)O)C |
| CAS | 34787014 |
| Splash | |
| Other Names |
| Wikipedia | Ticarcillin |
| ChemSpider | 390007 |
| PubChem | 441232 |