Systematic / IUPAC Name: 4'-Methyl-2'-vinylspiro[indole-3,7'-[9]oxa[4]azatetracyclo[6.3.1.02,6 05,11]dodecan]-2(1H)-one
ID: Reference2159
Other Names: Gelsemin
Formula: C20H22N2O2
Class: Natural Toxins Endogenous Metabolites Natural Products/Medicines
Gelsemine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/2/2015 2:56:58 PM |
| InChI | InChI=1S/C20H22N2O2/c1-3-19-10-22(2)16-11-9-24-15(8-13(11)19)20(17(16)19)12-6-4-5-7-14(12)21-18(20)23/h3-7,11,13,15-17H,1,8-10H2,2H3,(H,21,23) |
| InChI Key | NFYYATWFXNPTRM-UHFFFAOYSA-N |
| Canonical SMILES | CN1CC2(C3CC4C5(C2C1C3CO4)C6=CC=CC=C6NC5=O)C=C |
| CAS | 509159 |
| Splash | |
| Other Names | Gelsemin |
| ChemSpider | 245682 |
| PubChem | 279057 |
| ChEMBL | CHEMBL1979576 |
| Wikipedia | Gelsemine |