Systematic / IUPAC Name: 2-Amino-3-(2-methylidenecyclopropyl)propanoic acid
ID: Reference2196
Other Names:
Hypoglycine;
Hypoglycine A;
Cyclopropanealanine, 2-methylene-;
Hypoglycin;
α-Amino-2-methylenecyclopropanepropionic acid
; more
Formula: C7H11NO2
Class: Natural Toxins Endogenous Metabolites
Hypoglycin A mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/4/2015 3:10:10 PM |
| InChI | InChI=1S/C7H11NO2/c1-4-2-5(4)3-6(8)7(9)10/h5-6H,1-3,8H2,(H,9,10) |
| InChI Key | OOJZCXFXPZGUBJ-UHFFFAOYSA-N |
| Canonical SMILES | C=C1CC1CC(C(=O)O)N |
| CAS | 156569 |
| Splash | |
| Other Names |
Hypoglycine; Hypoglycine A; Cyclopropanealanine, 2-methylene-; Hypoglycin; α-Amino-2-methylenecyclopropanepropionic acid; 2-Methylenecyclopropanylalanine; α-Amino-β-(2-methylenecyclopropyl)propionic acid; 2-Methylenecyclopropanealanine; β-(Methylenecyclopropyl)alanine; 2-Amino-4,5-methylenehex-5-enoic acid; α-Aminomethylenecyclopropanepropionic acid; α-Amino-2-methylenecyclopropanepropanoic acid; Cyclopropanepropanoic acid, α-amino-2-methylene- |
| PubChem | 9081 |
| ChemSpider | 8728 |
| ChemIDPlus | 000156569 |
| Wikipedia | Hypoglycin |