Systematic / IUPAC Name: 2-[4-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)phenyl]propanoic acid
ID: Reference2205
Other Names:
Isindone;
Reumofene;
Flosin;
Flosint;
2-[4-(1-Oxoisoindolin-2-yl)phenyl]propanoic acid
; more
Formula: C17H15NO3
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Indoprofen mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/5/2015 12:28:36 PM |
| InChI | InChI=1S/C17H15NO3/c1-11(17(20)21)12-6-8-14(9-7-12)18-10-13-4-2-3-5-15(13)16(18)19/h2-9,11H,10H2,1H3,(H,20,21) |
| InChI Key | RJMIEHBSYVWVIN-UHFFFAOYSA-N |
| Canonical SMILES | CC(C1=CC=C(C=C1)N2CC3=CC=CC=C3C2=O)C(=O)O |
| CAS | 31842010 |
| Splash | |
| Other Names |
Isindone; Reumofene; Flosin; Flosint; 2-[4-(1-Oxoisoindolin-2-yl)phenyl]propanoic acid; 2-[4-(1-Carboxyethyl)phenyl]-1-isoindolinone; 1-Oxo-2-{p-[(α-methyl)carboxymethyl]phenyl}isoindoline; p-(1-Oxo-2-isoindolinyl)hydratropic acid; Hydratropic acid, p-(1-oxo-2-isoindolinyl)-; Benzeneacetic acid, 4-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)-α-methyl-; 2-[4-(1-Oxoisoindolin-2-yl)phenyl]propanoic acid; Propionic acid, 2-[p-(1-oxo-2-isoindolinyl)phenyl]-; Propionic acid, α-[4-(1-oxo-2-isoindolinyl)phenyl]-; α-Methyl-p-(1-oxo-2-isoindolinyl)-benzeneacetic acid; 4-(1,3-Dihydro-1-oxo-2H-isoindol-2-yl)-α-methylbenzeneacetic acid; α-Methyl-p-(1-oxo-2-isoindolinyl)benzeneacetic acid; 2-[4-(1-Oxo-2-isoindolinyl)phenyl]propanoic acid; 2-[4-(1-Oxo-2-isoindolinyl)phenyl]propionic acid; α-[4-(1-Oxo-2-isoindolinyl)phenyl]propionic acid; 2-[4-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)phenyl]propanoic acid |
| PubChem | 3718 |
| DrugBank | DB08951 |
| ChemSpider | 3587 |
| Wikipedia | Indoprofen |
| ChEBI | CHEBI:76162 |
| ChEMBL | CHEMBL15870 |
| KEGG | D04530 |
| ChemIDPlus | 031842010; 069674664; 053022609 |