Systematic / IUPAC Name: 3-[(3-Hydroxy-2-phenylpropanoyl)oxy]-8-isopropyl-8-methyl-8-azoniabicyclo[3.2.1]octane
ID: Reference2207
Other Names: (8-Methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate
Formula: C20H30NO3 +
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Ipratropium mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 164 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/31/2018 10:55:08 AM |
| InChI | InChI=1S/C20H30NO3/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15/h4-8,14,16-19,22H,9-13H2,1-3H3/q+1 |
| InChI Key | OEXHQOGQTVQTAT-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)[N+]1(C2CCC1CC(C2)OC(=O)C(CO)C3=CC=CC=C3)C |
| CAS | |
| Splash | |
| Other Names | (8-Methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate |
| Wikipedia | Ipratropium bromide |
| KEGG | C07052 |
| ChemSpider | 3615 |
| PubChem | 3746 |
| ChEMBL | CHEMBL1615433 |