Systematic / IUPAC Name: 5-Chloro-2-(4-chloro-2-{[(3,4-dichlorophenyl)carbamoyl]amino}phenoxy)benzenesulfonic acid
ID: Reference2214
Other Names: Benzenesulfonic acid, 5-chloro-2-[4-chloro-2-({[(3,4-dichlorophenyl)amino]carbonyl}amino)phenoxy]-
Formula: C19H12Cl4N2O5S
Class: Pesticides/Herbicides
Sulcofuron mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 39 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/6/2015 11:06:51 AM |
| InChI | InChI=1S/C19H12Cl4N2O5S/c20-10-1-5-16(30-17-6-2-11(21)8-18(17)31(27,28)29)15(7-10)25-19(26)24-12-3-4-13(22)14(23)9-12/h1-9H,(H2,24,25,26)(H,27,28,29) |
| InChI Key | MKUMTCOTMQPYTQ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1NC(=O)NC2=C(C=CC(=C2)Cl)OC3=C(C=C(C=C3)Cl)S(=O)(=O)O)Cl)Cl |
| CAS | 24019054 |
| Splash | |
| Other Names | Benzenesulfonic acid, 5-chloro-2-[4-chloro-2-({[(3,4-dichlorophenyl)amino]carbonyl}amino)phenoxy]- |
| ChemIDPlus | 003567257; 024019054 |
| ChemSpider | 56283 |
| PubChem | 62506 |
| ChEBI | CHEBI:59246 |