Systematic / IUPAC Name: (2S)-2-(2-Chlorophenyl)-2-(methylamino)cyclohexanone
ID: Reference2222
Other Names:
(S)-Ketamine;
L-Ketamine;
(S)-2-(o-chlorophenyl)-2-(methylamino)cyclohexanone;
cyclohexanone, 2-(2-chlorophenyl)-2-(methylamino), (2S)-;
(2S)-2-(2-chlorophenyl)-2-(methylamino)cyclohexanone
; more
Formula: C13H16ClNO
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs Sports Doping Drugs
Esketamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 46 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 11:59:25 AM |
| InChI | InChI=1S/C13H16ClNO/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14/h2-3,6-7,15H,4-5,8-9H2,1H3/t13-/m0/s1 |
| InChI Key | YQEZLKZALYSWHR-ZDUSSCGKSA-N |
| Canonical SMILES | CNC1(CCCCC1=O)C2=CC=CC=C2Cl |
| CAS | |
| Splash | |
| Other Names |
(S)-Ketamine; L-Ketamine; (S)-2-(o-chlorophenyl)-2-(methylamino)cyclohexanone; cyclohexanone, 2-(2-chlorophenyl)-2-(methylamino), (2S)-; (2S)-2-(2-chlorophenyl)-2-(methylamino)cyclohexanone; Cyclohexanone, 2-(2-chlorophenyl)-2-(methylamino), (S)-; (-)-Ketamine |
| ChEBI | CHEBI:60799 |
| PubChem | 182137 |
| ChemSpider | 158414 |
| KEGG | D07283 |
| ChEMBL | CHEMBL395091 |
| ChemIDPlus | 033643468 |
| Wikipedia | Esketamine |