Systematic / IUPAC Name: Sparteine
ID: Reference2233
Other Names: Lupinidine
Formula: C15H26N2
Class: Endogenous Metabolites Sports Doping Drugs Therapeutics/Prescription Drugs
Sparteine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/9/2015 3:15:38 PM |
| InChI | InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2 |
| InChI Key | SLRCCWJSBJZJBV-UHFFFAOYSA-N |
| Canonical SMILES | C1CCN2CC3CC(C2C1)CN4C3CCCC4 |
| CAS | 90391 |
| Splash | |
| Other Names | Lupinidine |