Systematic / IUPAC Name: 2-Phenoxypropanoic acid
ID: Reference227
Other Names:
2-Phenoxypropionic acid;
α-Methylphenoxyacetic acid;
Propionic acid, 2-phenoxy-;
α-Phenoxypropionic acid;
Propanoic acid, 2-phenoxy-
Formula: C9H10O3
2-Phenoxypropanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 187 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/26/2014 11:02:36 AM |
| InChI | InChI=1S/C9H10O3/c1-7(9(10)11)12-8-5-3-2-4-6-8/h2-7H,1H3,(H,10,11) |
| InChI Key | SXERGJJQSKIUIC-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)O)OC1=CC=CC=C1 |
| CAS | 940318 |
| Splash | |
| Other Names |
2-Phenoxypropionic acid; α-Methylphenoxyacetic acid; Propionic acid, 2-phenoxy-; α-Phenoxypropionic acid; Propanoic acid, 2-phenoxy-; α-Phenoxypropinic acid |