Systematic / IUPAC Name: (2S)-N-(2,6-Dimethylphenyl)-1-propylpiperidine-2-carboxamide
ID: Reference2273
Other Names:
Ropivacainum;
L-N-N-Propylpipecolic acid-2,6-xylidide;
S-Ropivacaine;
(2S)-N-(2,6-Dimethylphenyl)-1-propyl-2-piperidinecarboxamide
Formula: C17H26N2O
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Ropivacaine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/16/2015 12:39:23 PM |
| InChI | InChI=1S/C17H26N2O/c1-4-11-19-12-6-5-10-15(19)17(20)18-16-13(2)8-7-9-14(16)3/h7-9,15H,4-6,10-12H2,1-3H3,(H,18,20)/t15-/m0/s1 |
| InChI Key | ZKMNUMMKYBVTFN-HNNXBMFYSA-N |
| Canonical SMILES | CCCN1CCCCC1C(=O)NC2=C(C=CC=C2C)C |
| CAS | 84057954 |
| Splash | |
| Other Names |
Ropivacainum; L-N-N-Propylpipecolic acid-2,6-xylidide; S-Ropivacaine; (2S)-N-(2,6-Dimethylphenyl)-1-propyl-2-piperidinecarboxamide |
| Wikipedia | Ropivacaine |
| ChEBI | CHEBI:8890 |
| ChemSpider | 153165 |
| HMDb | HMDB14441 |
| PubChem | 175805 |
| KEGG | D08490; C07532 |
| ChEMBL | CHEMBL1077896 |
| DrugBank | DB00296 |