Systematic / IUPAC Name: (S)-[2,8-Bis(trifluoromethyl)quinolin-4-yl]-[(2R)-piperidin-2-yl]methanol
ID: Reference2275
Other Names:
(-)-Mefloquine;
4-Quinolinemethanol, α-(2R)-2-piperidinyl-2,8-bis(trifluoromethyl)-, (αS)-
Formula: C17H16F6N2O
Class: Therapeutics/Prescription Drugs
Mefloquine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/17/2015 9:13:21 AM |
| InChI | InChI=1S/C17H16F6N2O/c18-16(19,20)11-5-3-4-9-10(15(26)12-6-1-2-7-24-12)8-13(17(21,22)23)25-14(9)11/h3-5,8,12,15,24,26H,1-2,6-7H2/t12-,15+/m1/s1 |
| InChI Key | XEEQGYMUWCZPDN-DOMZBBRYSA-N |
| Canonical SMILES | C1CCNC(C1)C(C2=CC(=NC3=C2C=CC=C3C(F)(F)F)C(F)(F)F)O |
| CAS | |
| Splash | |
| Other Names |
(-)-Mefloquine; 4-Quinolinemethanol, α-(2R)-2-piperidinyl-2,8-bis(trifluoromethyl)-, (αS)- |
| KEGG | C07633; D04895 |
| ChemIDPlus | 053230107; 051742871 |
| ChEBI | CHEBI:63687 |
| ChEMBL | CHEMBL172 |
| PubChem | 40692 |
| Wikipedia | Mefloquine |
| ChemSpider | 37171 |