Systematic / IUPAC Name: (6aR)-10-Methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol
ID: Reference2297
Other Names:
Apocodein;
Apocodeine;
6a-β-Aporphin-11-OL, 10-methoxy-
Formula: C18H19NO2
Class: Sports Doping Drugs Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs
R(-)-Apocodeine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 164 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/19/2015 10:03:51 AM |
| InChI | InChI=1S/C18H19NO2/c1-19-9-8-11-4-3-5-13-16(11)14(19)10-12-6-7-15(21-2)18(20)17(12)13/h3-7,14,20H,8-10H2,1-2H3/t14-/m1/s1 |
| InChI Key | DZUOQMBJJSBONO-CQSZACIVSA-N |
| Canonical SMILES | CN1CCC2=CC=CC3=C2C1CC4=C3C(=C(C=C4)OC)O |
| CAS | |
| Splash | |
| Other Names |
Apocodein; Apocodeine; 6a-β-Aporphin-11-OL, 10-methoxy- |
| ChemSpider | 12028 |
| PubChem | 12545 |
| ChemIDPlus | 000641361 |
| ChEMBL | CHEMBL154709 |