Systematic / IUPAC Name: N-(3-Methyl-5-sulfamoyl-1,3,4-thiadiazol-2(3H)-ylidene)acetamide
ID: Reference2301
Other Names: Acetamide, N-[5-(aminosulfonyl)-3-methyl-1,3,4-thiadiazol-2(3H)-ylidene]-
Formula: C5H8N4O3S2
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Methazolamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/20/2015 1:11:18 PM |
| InChI | InChI=1S/C5H8N4O3S2/c1-3(10)7-4-9(2)8-5(13-4)14(6,11)12/h1-2H3,(H2,6,11,12) |
| InChI Key | FLOSMHQXBMRNHR-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)N=C1N(N=C(S1)S(=O)(=O)N)C |
| CAS | 554574 |
| Splash | |
| Other Names | Acetamide, N-[5-(aminosulfonyl)-3-methyl-1,3,4-thiadiazol-2(3H)-ylidene]- |
| ChemSpider | 21122102 |
| Wikipedia | Methazolamide |
| PubChem | 4100 |