Systematic / IUPAC Name: (S)-(6-Methoxyquinolin-4-yl)[(2R,4S,8R)-8-vinylquinuclidin-2-yl]methanol
ID: Reference2304
Other Names:
Quindine;
(3ξ,8α,9S)-6'-Methoxycinchonan-9-ol;
(S)-[(2S)-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol
Formula: C20H24N2O2
Class: Therapeutics/Prescription Drugs Endogenous Metabolites Natural Products/Medicines Sports Doping Drugs
Quinidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/20/2015 10:43:43 AM |
| InChI | InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13?,14?,19-,20-/m0/s1 |
| InChI Key | LOUPRKONTZGTKE-CLONCEMUSA-N |
| Canonical SMILES | COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O |
| CAS | 56542 |
| Splash | |
| Other Names |
Quindine; (3ξ,8α,9S)-6'-Methoxycinchonan-9-ol; (S)-[(2S)-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| ChEMBL | CHEMBL2355467 |
| ChemSpider | 21112306 |
| PubChem | 24096961 |
| Wikipedia | Quinidine |