Systematic / IUPAC Name: 2-(Ethylamino)-2-(3-methoxyphenyl)cyclohexanone
ID: Reference2309
Other Names: 2-(3-Methoxyphenyl)-2-(N-ethylamino)cyclohexanone
Formula: C15H21NO2
Class: Drugs of Abuse/Illegal Drugs
Methoxetamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 164 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/30/2016 8:40:36 AM |
| InChI | InChI=1S/C15H21NO2/c1-3-16-15(10-5-4-9-14(15)17)12-7-6-8-13(11-12)18-2/h6-8,11,16H,3-5,9-10H2,1-2H3 |
| InChI Key | LPKTWLVEGBNOOX-UHFFFAOYSA-N |
| Canonical SMILES | CCNC1(CCCCC1=O)C2=CC(=CC=C2)OC |
| CAS | 1239943760 |
| Splash | |
| Other Names | 2-(3-Methoxyphenyl)-2-(N-ethylamino)cyclohexanone |
| PubChem | 52911279 |
| ChemSpider | 24721792 |
| Wikipedia | Methoxetamine |