Systematic / IUPAC Name: 2-Chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)sulfanyl]benzoic acid
ID: Reference2316
Other Names:
2-Chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)thio]benzoic acid;
2-Chloro-6-[(4,6-dimethoxypyrimidin-2-yl)sulfanyl]benzoic acid;
Benzoic acid, 2-chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)thio]-
Formula: C13H11ClN2O4S
Class: Pesticides/Herbicides
Pyrithiobac mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 3380 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 2/23/2015 10:31:06 AM |
| InChI | InChI=1S/C13H11ClN2O4S/c1-19-9-6-10(20-2)16-13(15-9)21-8-5-3-4-7(14)11(8)12(17)18/h3-6H,1-2H3,(H,17,18) |
| InChI Key | QEGVVEOAVNHRAA-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=NC(=N1)SC2=C(C(=CC=C2)Cl)C(=O)O)OC |
| CAS | 123342938 |
| Splash | |
| Other Names |
2-Chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)thio]benzoic acid; 2-Chloro-6-[(4,6-dimethoxypyrimidin-2-yl)sulfanyl]benzoic acid; Benzoic acid, 2-chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)thio]- |
| PubChem | 91781 |
| ChemSpider | 82878 |
| ChEMBL | CHEMBL2251593 |
| ChemIDPlus | 123343168 |