Systematic / IUPAC Name: (3-Methylphenyl) N-methylcarbamate
ID: Reference2324
Other Names:
m-Tolyl methylcarbamate;
Metacrate;
MTMC;
Tsumacide;
3-Methylphenyl N-methylcarbamate
; more
Formula: C9H11NO2
Class: Pesticides/Herbicides
Metolcarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1225 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 2/24/2015 8:27:25 AM |
| InChI | InChI=1S/C9H11NO2/c1-7-4-3-5-8(6-7)12-9(11)10-2/h3-6H,1-2H3,(H,10,11) |
| InChI Key | VOEYXMAFNDNNED-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=CC=C1)OC(=O)NC |
| CAS | 1129415 |
| Splash | |
| Other Names |
m-Tolyl methylcarbamate; Metacrate; MTMC; Tsumacide; 3-Methylphenyl N-methylcarbamate; 3-Tolyl methylcarbamate; m-Cresyl methylcarbamate; m-Tolyl N-methylcarbamate; 3-Tolyl N-methylcarbamate; m-Cresyl N-methylcarbamate; m-Methylphenyl methylcarbamate; 3-Methylphenyl methylcarbamate; Metholcarb; Tsumaunka; Kumiai; Carbamic acid, methyl, 3-methylphenyl ester; Carbamic acid, methyl, m-tolyl ester; m-Cresyl ester of N-methylcarbamic acid; Methylcarbamic acid m-tolyl ester; Carbamic acid, N-methyl, 3-methylphenyl ester; Dicresyl; Tumacide; Dicresyl N-methylcarbamate |
| ChEMBL | CHEMBL2046816 |
| PubChem | 14322 |
| Wikipedia | Metolcarb |
| KEGG | C18747 |
| ChemIDPlus | 001129415 |
| ChemSpider | 13684 |
| ChEBI | CHEBI:38537 |