Systematic / IUPAC Name: N-(2,6-Dichloro-3-methylphenyl)-5,7-dimethoxy[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide
ID: Reference2327
Other Names: [1,2,4]Triazolo[1,5-a]pyrimidine-2-sulfonamide, N-(2,6-dichloro-3-methylphenyl)-5,7-dimethoxy-
Formula: C14H13Cl2N5O4S
Class: Pesticides/Herbicides
Metosulam mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 3421 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 2/24/2015 1:38:36 PM |
| InChI | InChI=1S/C14H13Cl2N5O4S/c1-7-4-5-8(15)12(11(7)16)20-26(22,23)14-18-13-17-9(24-2)6-10(25-3)21(13)19-14/h4-6,20H,1-3H3 |
| InChI Key | VGHPMIFEKOFHHQ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=C(C=C1)Cl)NS(=O)(=O)C2=NN3C(=CC(=NC3=N2)OC)OC)Cl |
| CAS | 139528851 |
| Splash | |
| Other Names | [1,2,4]Triazolo[1,5-a]pyrimidine-2-sulfonamide, N-(2,6-dichloro-3-methylphenyl)-5,7-dimethoxy- |
| ChEMBL | CHEMBL2288020 |
| HMDb | HMDB34850 |
| Wikipedia | Metosulam (DE) |
| ChemIDPlus | 139528851 |
| PubChem | 86422 |
| ChemSpider | 77938 |
| KEGG | C18867 |