Systematic / IUPAC Name: (1S,2S)-2-(Methylamino)-1-phenylpropan-1-ol
ID: Reference2334
Other Names:
Isoephedrine;
d-Pseudoephedrine;
d-Isoephedrine;
(+)-Pseudoephedrine;
trans-Ephedrine
; more
Formula: C10H15NO
Class: Sports Doping Drugs Drugs of Abuse/Illegal Drugs Therapeutics/Prescription Drugs Endogenous Metabolites Natural Products/Medicines
Pseudoephedrine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 155 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/26/2018 1:22:59 PM |
| InChI | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1 |
| InChI Key | KWGRBVOPPLSCSI-WCBMZHEXSA-N |
| Canonical SMILES | CC(C(C1=CC=CC=C1)O)NC |
| CAS | 90824 |
| Splash | |
| Other Names |
Isoephedrine; d-Pseudoephedrine; d-Isoephedrine; (+)-Pseudoephedrine; trans-Ephedrine; ξ-Ephedrin; Besan; ξ-Ephedrine; d-ξ-Ephedrine; (+)-ξ-Ephedrine; (+)-Threo-ephedrine; L(+)-ξ-Ephedrine; L-(+)-Pseudoephedrine; Pseudoefedrina; Pseudoephedrinum; Afrinol; Cenafed; Decofed; Genaphed; Maxenal; Myfedrine; Robidrine; (1S,2S)-(+)-Pseudoephedrine; (+)-(1S,2S)-Pseudoephedrine; (1S,2S)-Pseudoephedrine; Benylin decongestant; Sudafed decongestant; Dimetapp decongestant; Pseudoephedrine ephedrine; ξ-Ephedrine, (+)-; d-ξ-2-Methylamino-1-phenyl-1-propanol; Pseudoephedrine, L-(+)-; Pseudoephedrine, (+)-; α-(1-(Methylamino)ethyl)benzyl alcohol; Benzenemethanol, α-((1S)-1-(methylamino)ethyl)-, (α-S)-; Benzenemethanol, α-(1-(methylamino)ethyl)-, (S-(R*,R*))-; (1S,2S)-2-Methylamino-1-phenyl-1-propanol |
| DrugBank | DB00852 |
| ChemSpider | 6761 |
| HMDb | HMDB01943 |
| ChemIDPlus | 000090824 |
| ChEBI | CHEBI:51209 |
| PubChem | 7028 |
| Wikipedia | Pseudoephedrine |
| KEGG | D08449; C02765 |
| ChEMBL | CHEMBL1590 |