Systematic / IUPAC Name: 6-[2-(Dimethylamino)propyl]-6,11-dihydro-5H-pyrido[2,3-b][1,5]benzodiazepin-5-one
ID: Reference2343
Other Names:
Vagran 50 kapseln;
6,11-Dihydro-6-[2-(dimethylamino)-2-methylethyl]-5H-pyrido[2,3-b][1,5]benzodiazepin-5-one
Formula: C17H20N4O
Class: Therapeutics/Prescription Drugs
Propizepine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2015 8:54:12 AM |
| InChI | InChI=1S/C17H20N4O/c1-12(20(2)3)11-21-15-9-5-4-8-14(15)19-16-13(17(21)22)7-6-10-18-16/h4-10,12H,11H2,1-3H3,(H,18,19) |
| InChI Key | YFLBETLXDPBWTD-UHFFFAOYSA-N |
| Canonical SMILES | CC(CN1C2=CC=CC=C2NC3=C(C1=O)C=CC=N3)N(C)C |
| CAS | 10321127 |
| Splash | |
| Other Names |
Vagran 50 kapseln; 6,11-Dihydro-6-[2-(dimethylamino)-2-methylethyl]-5H-pyrido[2,3-b][1,5]benzodiazepin-5-one |
| ChemIDPlus | 010321127 |
| ChemSpider | 100443 |
| Wikipedia | Propizepine |
| PubChem | 112029 |