Systematic / IUPAC Name: 4-(Methylsulfanyl)phenyl dipropyl phosphate
ID: Reference2346
Other Names:
Kayphosnac;
Kayaphos;
4-Methylthiophenyl dipropyl phosphate;
Phosphoric acid, dipropyl 4-methylthiophenyl ester;
Phosphoric acid, 4-(methylthio)phenyl dipropyl ester
Formula: C13H21O4PS
Class: Pesticides/Herbicides
Propaphos mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2015 9:17:52 AM |
| InChI | InChI=1S/C13H21O4PS/c1-4-10-15-18(14,16-11-5-2)17-12-6-8-13(19-3)9-7-12/h6-9H,4-5,10-11H2,1-3H3 |
| InChI Key | PWYIUEFFPNVCMW-UHFFFAOYSA-N |
| Canonical SMILES | CCCOP(=O)(OCCC)OC1=CC=C(C=C1)SC |
| CAS | 7292162 |
| Splash | |
| Other Names |
Kayphosnac; Kayaphos; 4-Methylthiophenyl dipropyl phosphate; Phosphoric acid, dipropyl 4-methylthiophenyl ester; Phosphoric acid, 4-(methylthio)phenyl dipropyl ester; Phosphoric acid, p-(methylthio)phenyl dipropyl ester |
| KEGG | C19013 |
| PubChem | 23717 |
| ChEBI | CHEBI:38858 |
| ChemIDPlus | 007292162 |
| ChemSpider | 22177 |