Systematic / IUPAC Name: Methyl (16E,20β)-9,17-dimethoxycoryn-16-en-16-carboxylate
ID: Reference2388
Other Names:
9-Methoxycorynantheidine;
16,17-Didehydro-9,17-dimethoxy-17,18-seco-20-α-yohimban-16-carboxylic acid methyl ester
Formula: C23H30N2O4
Class: Drugs of Abuse/Illegal Drugs Endogenous Metabolites
Mitragynine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 164 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/24/2017 12:20:40 PM |
| InChI | InChI=1S/C23H30N2O4/c1-5-14-12-25-10-9-15-21-18(7-6-8-20(21)28-3)24-22(15)19(25)11-16(14)17(13-27-2)23(26)29-4/h6-8,13-14,16,19,24H,5,9-12H2,1-4H3/b17-13+/t14-,16+,19+/m1/s1 |
| InChI Key | LELBFTMXCIIKKX-QVRQZEMUSA-N |
| Canonical SMILES | CCC1CN2CCC3=C(C2CC1C(=COC)C(=O)OC)NC4=C3C(=CC=C4)OC |
| CAS | 4098402 |
| Splash | |
| Other Names |
9-Methoxycorynantheidine; 16,17-Didehydro-9,17-dimethoxy-17,18-seco-20-α-yohimban-16-carboxylic acid methyl ester |