Systematic / IUPAC Name: 1-(4-methylphenyl)-2-pyrrolidin-1-ylbutan-1-one
ID: Reference2396
Other Names:
1-Butanone, 1-(4-methylphenyl)-2-(1-pyrrolidinyl)-;
4'-Methyl-α-pyrrolidinobutiophenone;
F 1938 ;
4-Methyl PBP
Formula: C15H21NO
Class: Drugs of Abuse/Illegal Drugs
MPBP mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/4/2016 9:07:04 AM |
| InChI | InChI=1S/C15H21NO/c1-3-14(16-10-4-5-11-16)15(17)13-8-6-12(2)7-9-13/h6-9,14H,3-5,10-11H2,1-2H3 |
| InChI Key | NXNPGAAZKYDOPW-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C(=O)C1=CC=C(C=C1)C)N2CCCC2 |
| CAS | |
| Splash | |
| Other Names |
1-Butanone, 1-(4-methylphenyl)-2-(1-pyrrolidinyl)-; 4'-Methyl-α-pyrrolidinobutiophenone; F 1938 ; 4-Methyl PBP |
| Wikipedia | 4'-Methyl-a-pyrrolidinobutiophenone |
| ChemSpider | 52084421 |
| PubChem | 57486975 |