Systematic / IUPAC Name: 17-Allyl-7,8-didehydro-4,5-epoxymorphinan-3,6-diol
ID: Reference2411
Other Names:
Allorphine;
Morphinan-3,6-diol, 7,8-didehydro-4,5-epoxy-17-(2-propenyl)-
Formula: C19H21NO3
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs Sports Doping Drugs
Nalorphine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2015 3:42:03 PM |
| InChI | InChI=1S/C19H21NO3/c1-2-8-20-9-7-19-12-4-6-15(22)18(19)23-17-14(21)5-3-11(16(17)19)10-13(12)20/h2-6,12-13,15,18,21-22H,1,7-10H2 |
| InChI Key | UIQMVEYFGZJHCZ-UHFFFAOYSA-N |
| Canonical SMILES | C=CCN1CCC23C4C1CC5=C2C(=C(C=C5)O)OC3C(C=C4)O |
| CAS | |
| Splash | |
| Other Names |
Allorphine; Morphinan-3,6-diol, 7,8-didehydro-4,5-epoxy-17-(2-propenyl)- |
| PubChem | 4423 |
| ChEMBL | CHEMBL611473 |
| Wikipedia | Nalorphine |
| ChemSpider | 4270 |