Systematic / IUPAC Name: 9-Butyl-7-[(3-hydroxy-2-phenylpropanoyl)oxy]-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonane
ID: Reference2419
Other Names:
Formula: C21H30NO4 +
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
N-Butylscopolamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 12:02:21 PM |
| InChI | InChI=1S/C21H30NO4/c1-3-4-10-22(2)17-11-15(12-18(22)20-19(17)26-20)25-21(24)16(13-23)14-8-6-5-7-9-14/h5-9,15-20,23H,3-4,10-13H2,1-2H3/q+1 |
| InChI Key | YBCNXCRZPWQOBR-UHFFFAOYSA-N |
| Canonical SMILES | CCCC[N+]1(C2CC(CC1C3C2O3)OC(=O)C(CO)C4=CC=CC=C4)C |
| CAS | |
| Splash | |
| Other Names |
| ChemSpider | 3510 |
| ChEMBL | CHEMBL1178342 |
| PubChem | 3636 |