Systematic / IUPAC Name: 1-(2-Cyclopentylphenoxy)-3-[(2-methyl-2-propanyl)amino]-2-propanol
ID: Reference2434
Other Names:
1-(tert-Butylamino)-3-(2-cyclopentylphenoxy)propan-2-ol;
2-Propanol, 1-(2-cyclopentylphenoxy)-3-[(1,1-dimethylethyl)amino]-
Formula: C18H29NO2
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Penbutolol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/4/2015 12:36:26 PM |
| InChI | InChI=1S/C18H29NO2/c1-18(2,3)19-12-15(20)13-21-17-11-7-6-10-16(17)14-8-4-5-9-14/h6-7,10-11,14-15,19-20H,4-5,8-9,12-13H2,1-3H3 |
| InChI Key | KQXKVJAGOJTNJS-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)NCC(COC1=CC=CC=C1C2CCCC2)O |
| CAS | |
| Splash | |
| Other Names |
1-(tert-Butylamino)-3-(2-cyclopentylphenoxy)propan-2-ol; 2-Propanol, 1-(2-cyclopentylphenoxy)-3-[(1,1-dimethylethyl)amino]- |
| Wikipedia | Penbutolol |
| ChEMBL | CHEMBL26362 |
| ChemSpider | 4562 |
| PubChem | 4724 |