Systematic / IUPAC Name: S-Propyl N-butyl-N-ethylcarbamothioate
ID: Reference2437
Other Names:
Tillam;
Pebulat;
Carbamothioic acid, butylethyl, S-propyl ester;
Stauffer R-2061;
Propyl N-ethyl-N-butylthiocarbamate
; more
Formula: C10H21NOS
Class: Pesticides/Herbicides
Pebulate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1713 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/12/2015 2:30:13 PM |
| InChI | InChI=1S/C10H21NOS/c1-4-7-8-11(6-3)10(12)13-9-5-2/h4-9H2,1-3H3 |
| InChI Key | SGEJQUSYQTVSIU-UHFFFAOYSA-N |
| Canonical SMILES | CCCCN(CC)C(=O)SCCC |
| CAS | 1114712 |
| Splash | |
| Other Names |
Tillam; Pebulat; Carbamothioic acid, butylethyl, S-propyl ester; Stauffer R-2061; Propyl N-ethyl-N-butylthiocarbamate; Carbamic acid, butylethylthio, S-propyl ester; Propyl ethylbutylthiocarbamate; Propylethyl-N-butylthiocarbamate; S-Propyl butylethylthiocarbamate; S-Propyl butylethylcarbamothioate; Butylethylthiocarbamic acid S-propyl ester; Butylethylcarbamothioic acid S-propyl ester; S-(N-Propyl)-N-ethyl-N-butylthiocarbamate; N-Propyl-N-ethyl-N-(N-butyl)thiolcarbamate; S-(N-Propyl)-N-ethyl-N-N-butylthiocarbamate; PEBC |
| ChemSpider | 13579 |
| ChemIDPlus | 001114712; 051052530 |
| KEGG | C18755 |
| Wikipedia | Pebulat (DE) |
| PubChem | 14215 |
| ChEMBL | CHEMBL2251585 |