Systematic / IUPAC Name: 2-(Ethylamino)-1-phenylbutan-1-one
ID: Reference2442
Other Names:
1-Butanone, 2-(ethylamino)-1-phenyl-;
2-(Ethylamino)-1-phenyl-1-butanone
Formula: C12H17NO
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
N-Ethylbuphedrone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/27/2016 12:53:46 PM |
| InChI | InChI=1S/C12H17NO/c1-3-11(13-4-2)12(14)10-8-6-5-7-9-10/h5-9,11,13H,3-4H2,1-2H3 |
| InChI Key | HEPVRDHGUWFXJS-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C(=O)C1=CC=CC=C1)NCC |
| CAS | |
| Splash | |
| Other Names |
1-Butanone, 2-(ethylamino)-1-phenyl-; 2-(Ethylamino)-1-phenyl-1-butanone |
| Wikipedia | N-Ethylbuphedrone |
| ChemSpider | 15397161 |
| PubChem | 20326296 |