Systematic / IUPAC Name: 7-[(3-Hydroxy-2-phenylpropanoyl)oxy]-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonane
ID: Reference2462
Other Names: Methylscopolamine
Formula: C18H24NO4 +
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
N-Methylscopolamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2015 1:27:01 PM |
| InChI | InChI=1S/C18H24NO4/c1-19(2)14-8-12(9-15(19)17-16(14)23-17)22-18(21)13(10-20)11-6-4-3-5-7-11/h3-7,12-17,20H,8-10H2,1-2H3/q+1 |
| InChI Key | LZCOQTDXKCNBEE-UHFFFAOYSA-N |
| Canonical SMILES | C[N+]1(C2CC(CC1C3C2O3)OC(=O)C(CO)C4=CC=CC=C4)C |
| CAS | |
| Splash | |
| Other Names | Methylscopolamine |
| PubChem | 4120 |
| ChEMBL | CHEMBL107979 |
| Wikipedia | Methylscopolamine bromide |
| ChemSpider | 3977 |