Systematic / IUPAC Name: 1-(2-Chlorophenyl)piperazine
ID: Reference2483
Other Names:
Piperazine, 1-(2-chlorophenyl)-;
(2-Chlorophenyl)piperazine;
ortho-Chlorophenylpiperazine
Formula: C10H13ClN2
Class: Drugs of Abuse/Illegal Drugs Illegal Additives Endogenous Metabolites
1-(2-Chlorophenyl)piperazine (o-CPP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 112 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/7/2015 9:12:59 AM |
| InChI | InChI=1S/C10H13ClN2/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13/h1-4,12H,5-8H2 |
| InChI Key | PWZDJIUQHUGFRJ-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN1)C2=CC=CC=C2Cl |
| CAS | 39512500 |
| Splash | |
| Other Names |
Piperazine, 1-(2-chlorophenyl)-; (2-Chlorophenyl)piperazine; ortho-Chlorophenylpiperazine |
| ChemIDPlus | 039512500 |
| ChemSpider | 367977 |
| PubChem | 415628 |
| ChEMBL | CHEMBL9841 |