Systematic / IUPAC Name: N-[1-(2-Hydroxy-2-phenylethyl)-3-methylpiperidin-4-yl]-N-phenylpropanamide
ID: Reference2490
Other Names:
β-Hydroxy-3-methylfentanyl;
Propanamide, N-[1-(2-hydroxy-1-methyl-2-phenylethyl)-3-methyl-4-piperidinyl]-N-phenyl-;
OMF
Formula: C23H30N2O2
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs Endogenous Metabolites
Ohmefentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/19/2015 9:47:24 AM |
| InChI | InChI=1S/C23H30N2O2/c1-3-23(27)25(20-12-8-5-9-13-20)21-14-15-24(16-18(21)2)17-22(26)19-10-6-4-7-11-19/h4-13,18,21-22,26H,3,14-17H2,1-2H3 |
| InChI Key | FRPRNNRJTCONEC-UHFFFAOYSA-N |
| Canonical SMILES | CCC(=O)N(C1CCN(CC1C)CC(C2=CC=CC=C2)O)C3=CC=CC=C3 |
| CAS | 78995149 |
| Splash | |
| Other Names |
β-Hydroxy-3-methylfentanyl; Propanamide, N-[1-(2-hydroxy-1-methyl-2-phenylethyl)-3-methyl-4-piperidinyl]-N-phenyl-; OMF |
| ChemIDPlus | 078995149 |
| DrugBank | DB01570 |
| PubChem | 62279 |
| ChemSpider | 56080 |
| Wikipedia | Ohmefentanyl |