Systematic / IUPAC Name: 2-(4-Chlorophenoxy)acetic acid
ID: Reference2502
Other Names:
Tomatotone;
Acetic acid, (4-chlorophenoxy)-;
Tomato fix;
Tomato hold;
Acetic acid, 2-(4-chlorophenoxy)-
; more
Formula: C8H7ClO3
Class: Pesticides/Herbicides
4-Chlorophenoxyacetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive HF Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 66 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/20/2015 1:24:03 PM |
| InChI | InChI=1S/C8H7ClO3/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChI Key | SODPIMGUZLOIPE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1OCC(=O)O)Cl |
| CAS | 122883 |
| Splash | |
| Other Names |
Tomatotone; Acetic acid, (4-chlorophenoxy)-; Tomato fix; Tomato hold; Acetic acid, 2-(4-chlorophenoxy)-; 4-CPA; p-CPA |
| ChemSpider | 24438 |
| ChEBI | CHEBI:1808 |
| ChEMBL | CHEMBL178018 |
| Wikipedia | 4-Chlorophenoxyacetic acid |
| ChemIDPlus | 013730988; 000122883 |
| PubChem | 26229 |
| KEGG | C07088 |