Systematic / IUPAC Name: 5-Aminopentanoic acid
ID: Reference251
Other Names:
δ-Aminovaleric acid;
Valeric acid, 5-amino-;
δ-Amino-n-valeric acid;
5-Aminopentanoate;
5-Aminovalerate
; more
Formula: C5H11NO2
Class: Endogenous Metabolites
5-Aminovaleric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 4 |
| No. of Spectra | 640 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/1/2014 10:52:39 AM |
| InChI | InChI=1S/C5H11NO2/c6-4-2-1-3-5(7)8/h1-4,6H2,(H,7,8) |
| InChI Key | JJMDCOVWQOJGCB-UHFFFAOYSA-N |
| Canonical SMILES | C(CCN)CC(=O)O |
| CAS | 660888 |
| Splash | |
| Other Names |
δ-Aminovaleric acid; Valeric acid, 5-amino-; δ-Amino-n-valeric acid; 5-Aminopentanoate; 5-Aminovalerate; 5-Amino-n-valeric acid; δ-Aminovalerate; Pentanoic acid, 5-amino-; δ-Amino-n-valerate; Valeric acid, (5-amino)-; Danva |
| HMDb | HMDB03355; HMDB03355 |
| KEGG | C00431 |
| ChemSpider | 135 |
| ChemIDPlus | 000660888; 000627952 |
| PubChem | 138; 6992101 |
| ChEMBL | CHEMBL284116 |
| ChEBI | CHEBI:356010; CHEBI:15887 |