Systematic / IUPAC Name: (2S)-2-(9H-Fluoren-9-ylmethoxycarbonylamino)-2-(4-fluorophenyl)acetic acid
ID: Reference2537
Other Names: FMOC-4-fluoro-L-phenylglycine
Formula: C23H18FNO4
(S)-N-FMOC-4-fluorophenylglycine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 310 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 8/5/2015 12:49:12 PM |
| InChI | InChI=1S/C23H18FNO4/c24-15-11-9-14(10-12-15)21(22(26)27)25-23(28)29-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20-21H,13H2,(H,25,28)(H,26,27)/t21-/m0/s1 |
| InChI Key | UUEGPRZUDVECNF-NRFANRHFSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(C4=CC=C(C=C4)F)C(=O)O |
| CAS | 678988186 |
| Splash | |
| Other Names | FMOC-4-fluoro-L-phenylglycine |