Systematic / IUPAC Name: 1-(3,3'-Dimethyl-2,2'-bithiophen-5-yl)-1-propanone
ID: Reference2542
Other Names: 1-{4-methyl-5-[3-methyl(2-thienyl)]-2-thienyl}propan-1-one
Formula: C13H14OS2
1-(3,3'-Dimethyl-2,2'-bithiophen-5-yl)-propanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 79 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/5/2015 1:41:49 PM |
| InChI | InChI=1S/C13H14OS2/c1-4-10(14)11-7-9(3)13(16-11)12-8(2)5-6-15-12/h5-7H,4H2,1-3H3 |
| InChI Key | BLEJVUCHSCHCED-UHFFFAOYSA-N |
| Canonical SMILES | CCC(=O)C1=CC(=C(S1)C2=C(C=CS2)C)C |
| CAS | |
| Splash | |
| Other Names | 1-{4-methyl-5-[3-methyl(2-thienyl)]-2-thienyl}propan-1-one |