Systematic / IUPAC Name: Naphthalen-1-ol
ID: Reference2562
Other Names:
α-Naphthol;
α-Naphthyl alcohol;
1-Naphthalenol;
1-Naphthyl alcohol;
Naphthyl-1-ol
; more
Formula: C10H8O
Class: Industrial Chemicals Endogenous Metabolites Pesticides/Herbicides
1-Naphthol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 343 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 4/9/2015 1:08:54 PM |
| InChI | InChI=1S/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
| InChI Key | KJCVRFUGPWSIIH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2O |
| CAS | 90153 |
| Splash | |
| Other Names |
α-Naphthol; α-Naphthyl alcohol; 1-Naphthalenol; 1-Naphthyl alcohol; Naphthyl-1-ol; α-Hydroxynaphthalene; CI Oxidation base 33 |
| ChemIDPlus | 000090153; 019402712 |
| KEGG | C11714 |
| Wikipedia | 1-Naphthol |
| ChEBI | CHEBI:10319 |
| PubChem | 7005 |
| HMDb | HMDB12138 |
| ChemSpider | 6739 |