Systematic / IUPAC Name: Methyl pyridine-2-carboxylate
ID: Reference2565
Other Names:
2-Pyridinecarboxylic acid, methyl ester;
Methyl 2-pyridinecarboxylate;
Picolinic acid, methyl ester;
Pyridine-2-carboxylic acid methyl ester;
2-Picolinic acid methyl ester
Formula: C7H7NO2
Methyl picolinate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/8/2015 11:23:59 AM |
| InChI | InChI=1S/C7H7NO2/c1-10-7(9)6-4-2-3-5-8-6/h2-5H,1H3 |
| InChI Key | NMMIHXMBOZYNET-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=CC=CC=N1 |
| CAS | 2459076 |
| Splash | |
| Other Names |
2-Pyridinecarboxylic acid, methyl ester; Methyl 2-pyridinecarboxylate; Picolinic acid, methyl ester; Pyridine-2-carboxylic acid methyl ester; 2-Picolinic acid methyl ester; 2-Carbomethoxypyridine |