Systematic / IUPAC Name: 2,6-Diphenylphenol
ID: Reference2577
Other Names: [1,1':3',1''-Terphenyl]-2'-ol
Formula: C18H14O
Class: Excipients/Additives/Colorants
2,6-Diphenylphenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 4/10/2015 1:00:48 PM |
| InChI | InChI=1S/C18H14O/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-13,19H |
| InChI Key | ATGFTMUSEPZNJD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=C(C(=CC=C2)C3=CC=CC=C3)O |
| CAS | 2432113 |
| Splash | |
| Other Names | [1,1':3',1''-Terphenyl]-2'-ol |