Systematic / IUPAC Name: 2-Amino-2-indanecarboxylic acid
ID: Reference2587
Other Names:
1H-Indene-2-carboxylic acid, 2-amino-2,3-dihydro-;
2-Amino-2,3-dihydro-1H-indene-2-carboxylic acid;
2-Amino-2-indancarboxylic acid;
2-Amino-indan-2-carboxylic acid;
2-Aminoindane-2-carboxylic acid
Formula: C10H11NO2
2-Aminoindan-2-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/14/2015 2:23:28 PM |
| InChI | InChI=1S/C10H11NO2/c11-10(9(12)13)5-7-3-1-2-4-8(7)6-10/h1-4H,5-6,11H2,(H,12,13) |
| InChI Key | UHQFXIWMAQOCAN-UHFFFAOYSA-N |
| Canonical SMILES | C1C2=CC=CC=C2CC1(C(=O)O)N |
| CAS | 27473627 |
| Splash | |
| Other Names |
1H-Indene-2-carboxylic acid, 2-amino-2,3-dihydro-; 2-Amino-2,3-dihydro-1H-indene-2-carboxylic acid; 2-Amino-2-indancarboxylic acid; 2-Amino-indan-2-carboxylic acid; 2-Aminoindane-2-carboxylic acid |
| PubChem | 250936 |
| ChemSpider | 219791 |
| ChEMBL | CHEMBL1082953 |