Systematic / IUPAC Name: (2-Chlorophenyl)-phenylmethanone
ID: Reference2591
Other Names:
Benzophenone, 2-chloro-;
o-Chlorobenzophenone;
2-Chlorophenyl phenyl ketone;
Methanone, (2-chlorophenyl)phenyl-
Formula: C13H9ClO
Class: Endogenous Metabolites Therapeutics/Prescription Drugs
2-Chlorobenzophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/15/2015 12:59:57 PM |
| InChI | InChI=1S/C13H9ClO/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9H |
| InChI Key | VMHYWKBKHMYRNF-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2Cl |
| CAS | 5162038 |
| Splash | |
| Other Names |
Benzophenone, 2-chloro-; o-Chlorobenzophenone; 2-Chlorophenyl phenyl ketone; Methanone, (2-chlorophenyl)phenyl- |