Systematic / IUPAC Name: Ethyl tetradecanoate
ID: Reference2599
Other Names:
Ethyl N-tetradecanoate;
Myristic acid ethyl ester;
Tetradecanoic acid ethyl ester;
Ethyl tetradecanoate
Formula: C16H32O2
Class: Endogenous Metabolites Excipients/Additives/Colorants
Ethyl myristate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP ; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 6 |
| No. of Spectra | 2232 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 6/30/2017 1:50:26 PM |
| InChI | InChI=1S/C16H32O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)18-4-2/h3-15H2,1-2H3 |
| InChI Key | MMKRHZKQPFCLLS-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCCCCCCC(=O)OCC |
| CAS | 124061 |
| Splash | |
| Other Names |
Ethyl N-tetradecanoate; Myristic acid ethyl ester; Tetradecanoic acid ethyl ester; Ethyl tetradecanoate |
| ChemSpider | 29023 |
| HMDb | HMDB34153 |
| ChEMBL | CHEMBL207555 |
| ChemIDPlus | 000124061 |
| PubChem | 31283 |