Systematic / IUPAC Name: (5-Methoxy-1H-indol-3-yl)acetic acid
ID: Reference260
Other Names:
5-Methoxyindole-3-acetic acid;
Methoxyindoleacetic acid;
5-Methoxy-3-indoleacetic acid;
2-(5-Methoxy-1H-indol-3-yl)acetic acid;
5-Methoxyindoleacetate
; more
Formula: C11H11NO3
Class: Endogenous Metabolites
5-Methoxyindoleacetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 380 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/2/2014 2:36:58 PM |
| InChI | InChI=1S/C11H11NO3/c1-15-8-2-3-10-9(5-8)7(6-12-10)4-11(13)14/h2-3,5-6,12H,4H2,1H3,(H,13,14) |
| InChI Key | COCNDHOPIHDTHK-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC2=C(C=C1)NC=C2CC(=O)O |
| CAS | 3471316 |
| Splash | |
| Other Names |
5-Methoxyindole-3-acetic acid; Methoxyindoleacetic acid; 5-Methoxy-3-indoleacetic acid; 2-(5-Methoxy-1H-indol-3-yl)acetic acid; 5-Methoxyindoleacetate; Indole-3-acetic acid, 5-methoxy-; 1H-Indole-3-acetic acid, 5-methoxy-; 2-(5-Methoxyindol-3-yl)acetic acid; 5-Methoxyindole-3-acetate; 5-Methoxyindol-3-ylacetate |