Systematic / IUPAC Name: 1-(4-Phenylpiperidin-4-yl)ethanone
ID: Reference2609
Other Names:
1-(4-Phenyl-4-piperidinyl)ethanone;
Ethanone, 1-(4-phenyl-4-piperidinyl)-;
Methyl (4-phenyl-4-piperidyl) ketone;
Methyl (4-phenylpiperidin-4-yl)ketone
Formula: C13H17NO
4-Acetyl-4-phenylpiperidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/21/2015 12:13:58 PM |
| InChI | InChI=1S/C13H17NO/c1-11(15)13(7-9-14-10-8-13)12-5-3-2-4-6-12/h2-6,14H,7-10H2,1H3 |
| InChI Key | RKHWHRHOEKYEJW-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)C1(CCNCC1)C2=CC=CC=C2 |
| CAS | 34798806 |
| Splash | |
| Other Names |
1-(4-Phenyl-4-piperidinyl)ethanone; Ethanone, 1-(4-phenyl-4-piperidinyl)-; Methyl (4-phenyl-4-piperidyl) ketone; Methyl (4-phenylpiperidin-4-yl)ketone |
| ChEMBL | CHEMBL1498478 |
| PubChem | 101521 |
| ChemIDPlus | 034798806 |
| ChemSpider | 91734 |