Systematic / IUPAC Name: 2-Amino-3-(5-methoxy-1H-indol-3-yl)propanoic acid
ID: Reference2613
Other Names:
2-Amino-3-(5-methoxyindol-3-yl)propanoic acid;
DL-Tryptophan, 5-methoxy-
Formula: C12H14N2O3
Class: Endogenous Metabolites Therapeutics/Prescription Drugs
DL-5-Methoxytryptophan mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/21/2015 12:51:21 PM |
| InChI | InChI=1S/C12H14N2O3/c1-17-8-2-3-11-9(5-8)7(6-14-11)4-10(13)12(15)16/h2-3,5-6,10,14H,4,13H2,1H3,(H,15,16) |
| InChI Key | KVNPSKDDJARYKK-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC2=C(C=C1)NC=C2CC(C(=O)O)N |
| CAS | 28052848 |
| Splash | |
| Other Names |
2-Amino-3-(5-methoxyindol-3-yl)propanoic acid; DL-Tryptophan, 5-methoxy- |
| PubChem | 119802 |
| ChemIDPlus | 028052848 |
| ChEMBL | CHEMBL1491313 |
| ChemSpider | 106971 |