Systematic / IUPAC Name: 4-Oxo-4-thiophen-2-ylbutanoic acid
ID: Reference2617
Other Names:
3-(2-Thenoyl)propanoic acid;
4-(Thien-2-yl)-4-oxobutanoic acid;
4-(Thien-2-yl)-4-oxobutyric acid;
4-Oxo-4-(2-thienyl)butanoic acid;
4-Oxo-4-(2-thienyl)butyric acid
; more
Formula: C8H8O3S
4-Oxo-4-(2-thienyl)-butanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 357 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 4/22/2015 1:48:16 PM |
| InChI | InChI=1S/C8H8O3S/c9-6(3-4-8(10)11)7-2-1-5-12-7/h1-2,5H,3-4H2,(H,10,11) |
| InChI Key | ULJMYWHLMLRYSO-UHFFFAOYSA-N |
| Canonical SMILES | C1=CSC(=C1)C(=O)CCC(=O)O |
| CAS | 4653081 |
| Splash | |
| Other Names |
3-(2-Thenoyl)propanoic acid; 4-(Thien-2-yl)-4-oxobutanoic acid; 4-(Thien-2-yl)-4-oxobutyric acid; 4-Oxo-4-(2-thienyl)butanoic acid; 4-Oxo-4-(2-thienyl)butyric acid; 4-Oxo-4-(thien-2-yl)butanoic acid; 4-Oxo-4-(thien-2-yl)butyric acid; 4-Oxo-4-(thiophen-2-yl)butanoic acid; 4-Oxo-4-thien-2-ylbutanoic acid; 4-Oxo-4-thiophen-2-yl-butyric acid; 3-(α-Thenoyl)propionic acid; 3-(2-Thenoyl)-propionic acid; 4-(2-Thiophenyl)-4-oxobutanoic acid; 4-Oxo-4-(2-thiophenyl)butanoic acid |
| ChemIDPlus | 004653081 |
| ChEBI | CHEBI:64434 |
| ChemSpider | 70754 |
| PubChem | 78385 |