Systematic / IUPAC Name: 5-[(Chloromethyl)sulfanyl]-3-(methylsulfanyl)-1,2,4-thiadiazole
ID: Reference2626
Other Names: Chloro(3-methylthio(1,2,4-thiadiazol-5-ylthio))methane
Formula: C4H5ClN2S3
5-Chloromethylthio-3-methylmercapto-1,2,4-thiadiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 4/23/2015 11:15:49 AM |
| InChI | InChI=1S/C4H5ClN2S3/c1-8-3-6-4(9-2-5)10-7-3/h2H2,1H3 |
| InChI Key | VBRWFJPXQDNPEK-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=NSC(=N1)SCCl |
| CAS | |
| Splash | |
| Other Names | Chloro(3-methylthio(1,2,4-thiadiazol-5-ylthio))methane |