Systematic / IUPAC Name: 6-Methoxyquinoline
ID: Reference2627
Other Names:
p-Quinanisole;
Methyl 6-quinolyl ether;
Quinoline, 6-methoxy-
Formula: C10H9NO
Class: Excipients/Additives/Colorants
6-Methoxyquinoline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/23/2015 11:19:21 AM |
| InChI | InChI=1S/C10H9NO/c1-12-9-4-5-10-8(7-9)3-2-6-11-10/h2-7H,1H3 |
| InChI Key | HFDLDPJYCIEXJP-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC2=C(C=C1)N=CC=C2 |
| CAS | 5263876 |
| Splash | |
| Other Names |
p-Quinanisole; Methyl 6-quinolyl ether; Quinoline, 6-methoxy- |
| ChemIDPlus | 001321728; 005263876 |
| ChemSpider | 14170 |
| ChEBI | CHEBI:72822 |
| PubChem | 14860 |