Systematic / IUPAC Name: Propyl 3,4,5-trihydroxybenzoate
ID: Reference2638
Other Names:
Nipagallin P;
Nipanox S 1;
Progallin P;
Tenox PG;
3,4,5-Trihydroxybenzene-1-propylcarboxylate
; more
Formula: C10H12O5
Class: Extractables/Leachables Excipients/Additives/Colorants Personal Care Products/Cosmetics Industrial Chemicals
Propyl gallate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 562 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 3/29/2018 8:26:28 AM |
| InChI | InChI=1S/C10H12O5/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h4-5,11-13H,2-3H2,1H3 |
| InChI Key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| Canonical SMILES | CCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| CAS | 121799 |
| Splash | |
| Other Names |
Nipagallin P; Nipanox S 1; Progallin P; Tenox PG; 3,4,5-Trihydroxybenzene-1-propylcarboxylate; 3,4,5-Trihydroxybenzoic acid n-propyl ester; 3,4,5-Trihydroxybenzoic acid propyl ester; Benzoic acid, 3,4,5-trihydroxy-, propyl ester; Gallic acid propyl ester; Gallic acid, n-propyl ester; n-Propyl ester of 3,4,5-trihydroxybenzoic acid; n-Propyl gallate; n-Propyl-3,4,5-trihydroxybenzoate |
| ChEMBL | CHEMBL7983 |
| Wikipedia | Propyl gallate |
| KEGG | C11155; D02382 |
| HMDb | HMDB33835 |
| ChemSpider | 4778 |
| PubChem | 4947 |
| ChemIDPlus | 000121799 |