Systematic / IUPAC Name: Bis(2-methoxyethyl) benzene-1,2-dicarboxylate
ID: Reference2653
Other Names:
DMEP;
Kesscoflex MCP;
Kodaflex DMEP;
Methox;
Reomol P
; more
Formula: C14H18O6
Class: Extractables/Leachables
Dimethoxyethyl phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 328 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 6/2/2015 2:10:50 PM |
| InChI | InChI=1S/C14H18O6/c1-17-7-9-19-13(15)11-5-3-4-6-12(11)14(16)20-10-8-18-2/h3-6H,7-10H2,1-2H3 |
| InChI Key | HSUIVCLOAAJSRE-UHFFFAOYSA-N |
| Canonical SMILES | COCCOC(=O)C1=CC=CC=C1C(=O)OCCOC |
| CAS | 117828 |
| Splash | |
| Other Names |
DMEP; Kesscoflex MCP; Kodaflex DMEP; Methox; Reomol P; 1,2-Benzenedicarboxylic acid, 1,2-bis(2-methoxyethyl) ester; 1,2-Benzenedicarboxylic acid, bis(2-methoxyethyl) ester; 2-Methoxyethyl 2-[(2-methoxyethyl)oxycarbonyl]benzoate; 2-Methoxyethyl phthalate; Bis(2-methoxyethyl)phthalate; Bis(methoxyethyl)phthalate; Bis(methylglycol) phthalate; Dimethylglycol phthalate; Methoxy ethyl phthalate; Methyl glycol phthalate; Phthalic acid bis(2-methoxyethyl) ester |
| Wikipedia | Bis(2-methoxyethyl)phthalat (DE) |
| ChemSpider | 8041 |
| ChEMBL | CHEMBL1302251 |
| PubChem | 8344 |
| ChemIDPlus | 000117828 |